C9H7NO4S — CID 71140923
1-methylsulfonylindole-2,3-dione (PubChem CID 71140923) has the molecular formula C9H7NO4S and a molecular weight of 225.22 g/mol. Its IUPAC name is 1-methylsulfonylindole-2,3-dione.
| Compound Name | 1-methylsulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 71140923 |
| Molecular Formula | C9H7NO4S |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 1-methylsulfonylindole-2,3-dione |
| SMILES | CS(=O)(=O)N1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C9H7NO4S/c1-15(13,14)10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
| InChIKey | BVGXLMIDCHDPNC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|