About anthracene-9,10-dione;methanesulfonyl chloride
anthracene-9,10-dione;methanesulfonyl chloride (PubChem CID 174964861) has the molecular formula C15H11ClO4S
and a molecular weight of 322.77 g/mol. Its IUPAC name is anthracene-9,10-dione;methanesulfonyl chloride.
Molecular Properties
| Compound Name | anthracene-9,10-dione;methanesulfonyl chloride |
| PubChem CID | 174964861 |
| Molecular Formula | C15H11ClO4S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | anthracene-9,10-dione;methanesulfonyl chloride |
| SMILES | CS(=O)(=O)Cl.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H8O2.CH3ClO2S/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-5(2,3)4/h1-8H;1H3 |
| InChIKey | XSADTWSMJGSOSY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;methanesulfonyl chloride?
The IUPAC name of anthracene-9,10-dione;methanesulfonyl chloride (CID 174964861) is anthracene-9,10-dione;methanesulfonyl chloride.
What is the SMILES notation for anthracene-9,10-dione;methanesulfonyl chloride?
The canonical SMILES for anthracene-9,10-dione;methanesulfonyl chloride is CS(=O)(=O)Cl.O=C1c2ccccc2C(=O)c2ccccc21.
What is the InChIKey of anthracene-9,10-dione;methanesulfonyl chloride?
The InChIKey is XSADTWSMJGSOSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.CH3ClO2S/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-5(2,3)4/h1-8H;1H3.
What are the key properties of anthracene-9,10-dione;methanesulfonyl chloride?
anthracene-9,10-dione;methanesulfonyl chloride has a molecular weight of 322.77 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;methanesulfonyl chloride is sourced from PubChem (CID 174964861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).