C8H6NNaO6S — CID 131726548
sodium;2,3-dioxoindole-1-sulfonate;hydrate (PubChem CID 131726548) has the molecular formula C8H6NNaO6S and a molecular weight of 267.19 g/mol. Its IUPAC name is sodium;2,3-dioxoindole-1-sulfonate;hydrate.
| Compound Name | sodium;2,3-dioxoindole-1-sulfonate;hydrate |
|---|---|
| PubChem CID | 131726548 |
| Molecular Formula | C8H6NNaO6S |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | sodium;2,3-dioxoindole-1-sulfonate;hydrate |
| SMILES | O.O=C1C(=O)N(S(=O)(=O)[O-])c2ccccc21.[Na+] |
| InChI | InChI=1S/C8H5NO5S.Na.H2O/c10-7-5-3-1-2-4-6(5)9(8(7)11)15(12,13)14;;/h1-4H,(H,12,13,14);;1H2/q;+1;/p-1 |
| InChIKey | AHMJOKHWQVUYIY-UHFFFAOYSA-M |
| XLogP | -4.14 |
| TPSA | 126.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|