C12H7NO2S — CID 22022431
1-thiophen-3-ylindole-2,3-dione (PubChem CID 22022431) has the molecular formula C12H7NO2S and a molecular weight of 229.26 g/mol. Its IUPAC name is 1-thiophen-3-ylindole-2,3-dione.
| Compound Name | 1-thiophen-3-ylindole-2,3-dione |
|---|---|
| PubChem CID | 22022431 |
| Molecular Formula | C12H7NO2S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 1-thiophen-3-ylindole-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccsc2)c2ccccc21 |
| InChI | InChI=1S/C12H7NO2S/c14-11-9-3-1-2-4-10(9)13(12(11)15)8-5-6-16-7-8/h1-7H |
| InChIKey | LVOWFWVRAPVYDX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|