C18H10F2INOS — CID 142862565
3-[(3,5-difluoro-1λ5-iodacyclohexa-1,3,5-trien-1-ylidene)methylidene]-1-thiophen-3-ylindol-2-one (PubChem CID 142862565) has the molecular formula C18H10F2INOS and a molecular weight of 453.25 g/mol. Its IUPAC name is 3-[(3,5-difluoro-1λ5-iodacyclohexa-1,3,5-trien-1-ylidene)methylidene]-1-thiophen-3-ylindol-2-one.
| Compound Name | 3-[(3,5-difluoro-1λ5-iodacyclohexa-1,3,5-trien-1-ylidene)methylidene]-1-thiophen-3-ylindol-2-one |
|---|---|
| PubChem CID | 142862565 |
| Molecular Formula | C18H10F2INOS |
| Molecular Weight | 453.25 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | 3-[(3,5-difluoro-1λ5-iodacyclohexa-1,3,5-trien-1-ylidene)methylidene]-1-thiophen-3-ylindol-2-one |
| SMILES | O=C1C(=C=I2=CC(F)=CC(F)=C2)c2ccccc2N1c1ccsc1 |
| InChI | InChI=1S/C18H10F2INOS/c19-12-7-13(20)9-21(8-12)10-16-15-3-1-2-4-17(15)22(18(16)23)14-5-6-24-11-14/h1-9,11H |
| InChIKey | OTGZVQVAVGNVHK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|