C28H18FN3O3S — CID 67616839
2-[(3S)-5-(2-fluorophenyl)-2-oxo-1-(thiophen-3-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione (PubChem CID 67616839) has the molecular formula C28H18FN3O3S and a molecular weight of 495.54 g/mol. Its IUPAC name is 2-[(3S)-5-(2-fluorophenyl)-2-oxo-1-(thiophen-3-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3S)-5-(2-fluorophenyl)-2-oxo-1-(thiophen-3-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67616839 |
| Molecular Formula | C28H18FN3O3S |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[(3S)-5-(2-fluorophenyl)-2-oxo-1-(thiophen-3-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1[C@H](N2C(=O)c3ccccc3C2=O)N=C(c2ccccc2F)c2ccccc2N1Cc1ccsc1 |
| InChI | InChI=1S/C28H18FN3O3S/c29-22-11-5-3-9-20(22)24-21-10-4-6-12-23(21)31(15-17-13-14-36-16-17)28(35)25(30-24)32-26(33)18-7-1-2-8-19(18)27(32)34/h1-14,16,25H,15H2/t25-/m0/s1 |
| InChIKey | SZADEBPGSNVIPW-VWLOTQADSA-N |
| XLogP | 4.89 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|