C29H19FN4O3 — CID 19081206
2-[5-(2-fluorophenyl)-2-oxo-1-(pyridin-2-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione (PubChem CID 19081206) has the molecular formula C29H19FN4O3 and a molecular weight of 490.49 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-2-oxo-1-(pyridin-2-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-(2-fluorophenyl)-2-oxo-1-(pyridin-2-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19081206 |
| Molecular Formula | C29H19FN4O3 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-2-oxo-1-(pyridin-2-ylmethyl)-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1C(N2C(=O)c3ccccc3C2=O)N=C(c2ccccc2F)c2ccccc2N1Cc1ccccn1 |
| InChI | InChI=1S/C29H19FN4O3/c30-23-14-5-3-12-21(23)25-22-13-4-6-15-24(22)33(17-18-9-7-8-16-31-18)29(37)26(32-25)34-27(35)19-10-1-2-11-20(19)28(34)36/h1-16,26H,17H2 |
| InChIKey | UNCHGIHLLPXDFY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|