C27H20FN3O3 — CID 139681953
2-[5-(2-fluorophenyl)-1-(2-methylprop-2-enyl)-2-oxo-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione (PubChem CID 139681953) has the molecular formula C27H20FN3O3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1-(2-methylprop-2-enyl)-2-oxo-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-(2-fluorophenyl)-1-(2-methylprop-2-enyl)-2-oxo-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139681953 |
| Molecular Formula | C27H20FN3O3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1-(2-methylprop-2-enyl)-2-oxo-3H-1,4-benzodiazepin-3-yl]isoindole-1,3-dione |
| SMILES | C=C(C)CN1C(=O)C(N2C(=O)c3ccccc3C2=O)N=C(c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C27H20FN3O3/c1-16(2)15-30-22-14-8-6-12-20(22)23(19-11-5-7-13-21(19)28)29-24(27(30)34)31-25(32)17-9-3-4-10-18(17)26(31)33/h3-14,24H,1,15H2,2H3 |
| InChIKey | DMVZMNATBRRRKE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|