C22H20N2OS — CID 142957201
3-(5-propan-2-ylcyclohepta-1,3,5-trien-1-yl)imino-1-thiophen-3-ylindol-2-one (PubChem CID 142957201) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-(5-propan-2-ylcyclohepta-1,3,5-trien-1-yl)imino-1-thiophen-3-ylindol-2-one.
| Compound Name | 3-(5-propan-2-ylcyclohepta-1,3,5-trien-1-yl)imino-1-thiophen-3-ylindol-2-one |
|---|---|
| PubChem CID | 142957201 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-(5-propan-2-ylcyclohepta-1,3,5-trien-1-yl)imino-1-thiophen-3-ylindol-2-one |
| SMILES | CC(C)C1=CCC(/N=C2/C(=O)N(c3ccsc3)c3ccccc32)=CC=C1 |
| InChI | InChI=1S/C22H20N2OS/c1-15(2)16-6-5-7-17(11-10-16)23-21-19-8-3-4-9-20(19)24(22(21)25)18-12-13-26-14-18/h3-10,12-15H,11H2,1-2H3/b23-21+ |
| InChIKey | MXTMCKHISQYRGZ-XTQSDGFTSA-N |
| XLogP | 5.64 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|