C20H15ClN2OS — CID 142957205
(7Z,9E)-3-(4-chlorophenyl)imino-1-thiophen-3-yl-5,6-dihydrocycloocta[b]pyrrol-2-one (PubChem CID 142957205) has the molecular formula C20H15ClN2OS and a molecular weight of 366.87 g/mol. Its IUPAC name is (7Z,9E)-3-(4-chlorophenyl)imino-1-thiophen-3-yl-5,6-dihydrocycloocta[b]pyrrol-2-one.
| Compound Name | (7Z,9E)-3-(4-chlorophenyl)imino-1-thiophen-3-yl-5,6-dihydrocycloocta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 142957205 |
| Molecular Formula | C20H15ClN2OS |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (7Z,9E)-3-(4-chlorophenyl)imino-1-thiophen-3-yl-5,6-dihydrocycloocta[b]pyrrol-2-one |
| SMILES | O=C1/C(=N\c2ccc(Cl)cc2)C2=CCC/C=C\C=C/2N1c1ccsc1 |
| InChI | InChI=1S/C20H15ClN2OS/c21-14-7-9-15(10-8-14)22-19-17-5-3-1-2-4-6-18(17)23(20(19)24)16-11-12-25-13-16/h2,4-13H,1,3H2/b4-2-,17-5?,18-6+,22-19- |
| InChIKey | IZLGFFPYHKKAKP-ZXNRGBJBSA-N |
| XLogP | 5.68 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|