C20H15Cl2N3O — CID 163533795
3-(3,4-dichlorophenyl)imino-1-(pyridin-2-ylmethyl)-5,6-dihydroindol-2-one (PubChem CID 163533795) has the molecular formula C20H15Cl2N3O and a molecular weight of 384.27 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)imino-1-(pyridin-2-ylmethyl)-5,6-dihydroindol-2-one.
| Compound Name | 3-(3,4-dichlorophenyl)imino-1-(pyridin-2-ylmethyl)-5,6-dihydroindol-2-one |
|---|---|
| PubChem CID | 163533795 |
| Molecular Formula | C20H15Cl2N3O |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)imino-1-(pyridin-2-ylmethyl)-5,6-dihydroindol-2-one |
| SMILES | O=C1/C(=N\c2ccc(Cl)c(Cl)c2)C2=CCCC=C2N1Cc1ccccn1 |
| InChI | InChI=1S/C20H15Cl2N3O/c21-16-9-8-13(11-17(16)22)24-19-15-6-1-2-7-18(15)25(20(19)26)12-14-5-3-4-10-23-14/h3-11H,1-2,12H2/b24-19- |
| InChIKey | DVFKSTUADVRVAP-CLCOLTQESA-N |
| XLogP | 5.11 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|