C21H13Cl2N3O4 — CID 163301099
N-(3,5-dichloro-4-hydroxyphenyl)-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 163301099) has the molecular formula C21H13Cl2N3O4 and a molecular weight of 442.26 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 163301099 |
| Molecular Formula | C21H13Cl2N3O4 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)c1ccc2c(c1)C(=O)N(Cc1ccccn1)C2=O |
| InChI | InChI=1S/C21H13Cl2N3O4/c22-16-8-13(9-17(23)18(16)27)25-19(28)11-4-5-14-15(7-11)21(30)26(20(14)29)10-12-3-1-2-6-24-12/h1-9,27H,10H2,(H,25,28) |
| InChIKey | JPOJINYEBPRIAC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|