C27H21N5O4 — CID 108767006
N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 108767006) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108767006 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1cc(C)nc(Oc2cccc(NC(=O)c3ccc4c(c3)C(=O)N(Cc3ccccn3)C4=O)c2)n1 |
| InChI | InChI=1S/C27H21N5O4/c1-16-12-17(2)30-27(29-16)36-21-8-5-7-19(14-21)31-24(33)18-9-10-22-23(13-18)26(35)32(25(22)34)15-20-6-3-4-11-28-20/h3-14H,15H2,1-2H3,(H,31,33) |
| InChIKey | CHTPNBYNEVDMQS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|