C27H20N4O4 — CID 108767009
N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 108767009) has the molecular formula C27H20N4O4 and a molecular weight of 464.48 g/mol. Its IUPAC name is N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 108767009 |
| Molecular Formula | C27H20N4O4 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | Cc1cc(C)nc(Oc2cccc(NC(=O)c3ccc(N4C(=O)c5ccccc5C4=O)cc3)c2)n1 |
| InChI | InChI=1S/C27H20N4O4/c1-16-14-17(2)29-27(28-16)35-21-7-5-6-19(15-21)30-24(32)18-10-12-20(13-11-18)31-25(33)22-8-3-4-9-23(22)26(31)34/h3-15H,1-2H3,(H,30,32) |
| InChIKey | LKVVXEDOMIGWNN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|