C22H16N2O3S — CID 9402903
4-(1,3-dioxoisoindol-2-yl)-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 9402903) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 9402903 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C22H16N2O3S/c1-28-17-6-4-5-15(13-17)23-20(25)14-9-11-16(12-10-14)24-21(26)18-7-2-3-8-19(18)22(24)27/h2-13H,1H3,(H,23,25) |
| InChIKey | OQPXPHUTCDMZNJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|