C23H17N3O6 — CID 108768078
methyl 3-[[1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carbonyl]amino]-2-hydroxybenzoate (PubChem CID 108768078) has the molecular formula C23H17N3O6 and a molecular weight of 431.40 g/mol. Its IUPAC name is methyl 3-[[1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carbonyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carbonyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 108768078 |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | methyl 3-[[1,3-dioxo-2-(pyridin-2-ylmethyl)isoindole-5-carbonyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccn2)C3=O)c1O |
| InChI | InChI=1S/C23H17N3O6/c1-32-23(31)16-6-4-7-18(19(16)27)25-20(28)13-8-9-15-17(11-13)22(30)26(21(15)29)12-14-5-2-3-10-24-14/h2-11,27H,12H2,1H3,(H,25,28) |
| InChIKey | WZBKNWHPLCQEJW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|