C23H22N2O6 — CID 56576167
methyl 3-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-2-hydroxybenzoate (PubChem CID 56576167) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 3-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 56576167 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | methyl 3-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-2-hydroxybenzoate |
| SMILES | CCOc1cc(C(=O)Nc2cccc(C(=O)OC)c2O)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C23H22N2O6/c1-3-30-20-13-16(7-8-19(20)31-14-15-9-11-24-12-10-15)22(27)25-18-6-4-5-17(21(18)26)23(28)29-2/h4-13,26H,3,14H2,1-2H3,(H,25,27) |
| InChIKey | QHLWBEURSHQRBI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|