C12H8Cl2N2O2 — CID 82884387
N-(3,5-dichloro-4-hydroxyphenyl)pyridine-2-carboxamide (PubChem CID 82884387) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)pyridine-2-carboxamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 82884387 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)c1ccccn1 |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-8-5-7(6-9(14)11(8)17)16-12(18)10-3-1-2-4-15-10/h1-6,17H,(H,16,18) |
| InChIKey | LVYZFBMSWQYURV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|