C12H9Cl2N3O — CID 127034375
N'-(2,6-dichlorophenyl)pyridine-2-carbohydrazide (PubChem CID 127034375) has the molecular formula C12H9Cl2N3O and a molecular weight of 282.13 g/mol. Its IUPAC name is N'-(2,6-dichlorophenyl)pyridine-2-carbohydrazide.
| Compound Name | N'-(2,6-dichlorophenyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 127034375 |
| Molecular Formula | C12H9Cl2N3O |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | N'-(2,6-dichlorophenyl)pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1c(Cl)cccc1Cl)c1ccccn1 |
| InChI | InChI=1S/C12H9Cl2N3O/c13-8-4-3-5-9(14)11(8)16-17-12(18)10-6-1-2-7-15-10/h1-7,16H,(H,17,18) |
| InChIKey | IUZKWIKOPNIFEL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|