C7H9N5O2 — CID 175507593
1-amino-3-(pyridine-2-carbonylamino)urea (PubChem CID 175507593) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-amino-3-(pyridine-2-carbonylamino)urea.
| Compound Name | 1-amino-3-(pyridine-2-carbonylamino)urea |
|---|---|
| PubChem CID | 175507593 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-amino-3-(pyridine-2-carbonylamino)urea |
| SMILES | NNC(=O)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C7H9N5O2/c8-10-7(14)12-11-6(13)5-3-1-2-4-9-5/h1-4H,8H2,(H,11,13)(H2,10,12,14) |
| InChIKey | VRBTWIQNXMBYFD-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|