C11H7Br2N3O2S — CID 9330718
N'-(4,5-dibromothiophene-2-carbonyl)pyridine-2-carbohydrazide (PubChem CID 9330718) has the molecular formula C11H7Br2N3O2S and a molecular weight of 405.07 g/mol. Its IUPAC name is N'-(4,5-dibromothiophene-2-carbonyl)pyridine-2-carbohydrazide.
| Compound Name | N'-(4,5-dibromothiophene-2-carbonyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 9330718 |
| Molecular Formula | C11H7Br2N3O2S |
| Molecular Weight | 405.07 g/mol |
| Exact Mass | 402.86 |
| IUPAC Name | N'-(4,5-dibromothiophene-2-carbonyl)pyridine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(Br)c(Br)s1)c1ccccn1 |
| InChI | InChI=1S/C11H7Br2N3O2S/c12-6-5-8(19-9(6)13)11(18)16-15-10(17)7-3-1-2-4-14-7/h1-5H,(H,15,17)(H,16,18) |
| InChIKey | JXCXPELBMDMNSA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|