C14H12Br2N2O2S — CID 18291485
4,5-dibromo-N'-(4-ethylbenzoyl)thiophene-2-carbohydrazide (PubChem CID 18291485) has the molecular formula C14H12Br2N2O2S and a molecular weight of 432.14 g/mol. Its IUPAC name is 4,5-dibromo-N'-(4-ethylbenzoyl)thiophene-2-carbohydrazide.
| Compound Name | 4,5-dibromo-N'-(4-ethylbenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 18291485 |
| Molecular Formula | C14H12Br2N2O2S |
| Molecular Weight | 432.14 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | 4,5-dibromo-N'-(4-ethylbenzoyl)thiophene-2-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C14H12Br2N2O2S/c1-2-8-3-5-9(6-4-8)13(19)17-18-14(20)11-7-10(15)12(16)21-11/h3-7H,2H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | HJUBXQWSYHLLML-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.14 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|