C14H12Br2OS — CID 114963430
1-(4,5-dibromothiophen-2-yl)-2-(4-ethylphenyl)ethanone (PubChem CID 114963430) has the molecular formula C14H12Br2OS and a molecular weight of 388.12 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-(4-ethylphenyl)ethanone.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-(4-ethylphenyl)ethanone |
|---|---|
| PubChem CID | 114963430 |
| Molecular Formula | C14H12Br2OS |
| Molecular Weight | 388.12 g/mol |
| Exact Mass | 385.90 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-(4-ethylphenyl)ethanone |
| SMILES | CCc1ccc(CC(=O)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C14H12Br2OS/c1-2-9-3-5-10(6-4-9)7-12(17)13-8-11(15)14(16)18-13/h3-6,8H,2,7H2,1H3 |
| InChIKey | UIAKIMUGFUGZMJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.12 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |