C12H6Br2F2OS — CID 80532645
1-(4,5-dibromothiophen-2-yl)-2-(2,4-difluorophenyl)ethanone (PubChem CID 80532645) has the molecular formula C12H6Br2F2OS and a molecular weight of 396.05 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-(2,4-difluorophenyl)ethanone.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 80532645 |
| Molecular Formula | C12H6Br2F2OS |
| Molecular Weight | 396.05 g/mol |
| Exact Mass | 393.85 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-(2,4-difluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1F)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H6Br2F2OS/c13-8-5-11(18-12(8)14)10(17)3-6-1-2-7(15)4-9(6)16/h1-2,4-5H,3H2 |
| InChIKey | KVRLIGQYGAZVJK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |