C12H7BrF2O2 — CID 64561569
1-(3-bromofuran-2-yl)-2-(2,4-difluorophenyl)ethanone (PubChem CID 64561569) has the molecular formula C12H7BrF2O2 and a molecular weight of 301.09 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(2,4-difluorophenyl)ethanone.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 64561569 |
| Molecular Formula | C12H7BrF2O2 |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(2,4-difluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1F)c1occc1Br |
| InChI | InChI=1S/C12H7BrF2O2/c13-9-3-4-17-12(9)11(16)5-7-1-2-8(14)6-10(7)15/h1-4,6H,5H2 |
| InChIKey | JMEKTLHVDKDNGY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |