C12H7Br2FOS — CID 80532635
1-(4,5-dibromothiophen-2-yl)-2-(4-fluorophenyl)ethanone (PubChem CID 80532635) has the molecular formula C12H7Br2FOS and a molecular weight of 378.06 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 80532635 |
| Molecular Formula | C12H7Br2FOS |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 375.86 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H7Br2FOS/c13-9-6-11(17-12(9)14)10(16)5-7-1-3-8(15)4-2-7/h1-4,6H,5H2 |
| InChIKey | OTKXLAGSFGJRGM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |