C5HBr3OS — CID 15753564
4,5-dibromothiophene-2-carbonyl bromide (PubChem CID 15753564) has the molecular formula C5HBr3OS and a molecular weight of 348.84 g/mol. Its IUPAC name is 4,5-dibromothiophene-2-carbonyl bromide.
| Compound Name | 4,5-dibromothiophene-2-carbonyl bromide |
|---|---|
| PubChem CID | 15753564 |
| Molecular Formula | C5HBr3OS |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 345.73 |
| IUPAC Name | 4,5-dibromothiophene-2-carbonyl bromide |
| SMILES | O=C(Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C5HBr3OS/c6-2-1-3(4(7)9)10-5(2)8/h1H |
| InChIKey | QHUBEWQQYINVPI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|