C9H8Br2OS — CID 115780757
1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-en-1-one (PubChem CID 115780757) has the molecular formula C9H8Br2OS and a molecular weight of 324.04 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-en-1-one.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 115780757 |
| Molecular Formula | C9H8Br2OS |
| Molecular Weight | 324.04 g/mol |
| Exact Mass | 321.87 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H8Br2OS/c1-5(2)3-7(12)8-4-6(10)9(11)13-8/h3-4H,1-2H3 |
| InChIKey | YUPRJFXWYDSBHF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.04 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|