C5HBr2LiO2S — CID 19205739
lithium 4,5-dibromothiophene-2-carboxylate (PubChem CID 19205739) has the molecular formula C5HBr2LiO2S and a molecular weight of 291.88 g/mol. Its IUPAC name is lithium 4,5-dibromothiophene-2-carboxylate.
| Compound Name | lithium 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19205739 |
| Molecular Formula | C5HBr2LiO2S |
| Molecular Weight | 291.88 g/mol |
| Exact Mass | 289.82 |
| IUPAC Name | lithium 4,5-dibromothiophene-2-carboxylate |
| SMILES | O=C([O-])c1cc(Br)c(Br)s1.[Li+] |
| InChI | InChI=1S/C5H2Br2O2S.Li/c6-2-1-3(5(8)9)10-4(2)7;/h1H,(H,8,9);/q;+1/p-1 |
| InChIKey | DAJDTCFCBBDXCT-UHFFFAOYSA-M |
| XLogP | -1.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.88 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |