C10H12Br2O3S2 — CID 114974548
1-(4,5-dibromothiophen-2-yl)-4-ethylsulfonylbutan-1-one (PubChem CID 114974548) has the molecular formula C10H12Br2O3S2 and a molecular weight of 404.15 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-4-ethylsulfonylbutan-1-one.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-4-ethylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 114974548 |
| Molecular Formula | C10H12Br2O3S2 |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.86 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-4-ethylsulfonylbutan-1-one |
| SMILES | CCS(=O)(=O)CCCC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H12Br2O3S2/c1-2-17(14,15)5-3-4-8(13)9-6-7(11)10(12)16-9/h6H,2-5H2,1H3 |
| InChIKey | FDLUMMRHVPHMPC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |