C10H10Br2OS — CID 115802878
1-(4,5-dibromothiophen-2-yl)-4-methylpent-4-en-1-one (PubChem CID 115802878) has the molecular formula C10H10Br2OS and a molecular weight of 338.06 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-4-methylpent-4-en-1-one.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-4-methylpent-4-en-1-one |
|---|---|
| PubChem CID | 115802878 |
| Molecular Formula | C10H10Br2OS |
| Molecular Weight | 338.06 g/mol |
| Exact Mass | 335.88 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-4-methylpent-4-en-1-one |
| SMILES | C=C(C)CCC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H10Br2OS/c1-6(2)3-4-8(13)9-5-7(11)10(12)14-9/h5H,1,3-4H2,2H3 |
| InChIKey | ATLQLGOIDAQXJI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|