C11H14Br2O2S — CID 103024578
1-(4,5-dibromothiophen-2-yl)-4-methoxy-4-methylpentan-1-one (PubChem CID 103024578) has the molecular formula C11H14Br2O2S and a molecular weight of 370.11 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-4-methoxy-4-methylpentan-1-one.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-4-methoxy-4-methylpentan-1-one |
|---|---|
| PubChem CID | 103024578 |
| Molecular Formula | C11H14Br2O2S |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-4-methoxy-4-methylpentan-1-one |
| SMILES | COC(C)(C)CCC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H14Br2O2S/c1-11(2,15-3)5-4-8(14)9-6-7(12)10(13)16-9/h6H,4-5H2,1-3H3 |
| InChIKey | FACMCBIGBHKMJG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |