C11H14Br2OS — CID 114970028
1-(4,5-dibromothiophen-2-yl)-4,4-dimethylpentan-1-one (PubChem CID 114970028) has the molecular formula C11H14Br2OS and a molecular weight of 354.11 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-4,4-dimethylpentan-1-one.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 114970028 |
| Molecular Formula | C11H14Br2OS |
| Molecular Weight | 354.11 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H14Br2OS/c1-11(2,3)5-4-8(14)9-6-7(12)10(13)15-9/h6H,4-5H2,1-3H3 |
| InChIKey | SYGXGEFZGTYBLW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.11 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |