C7H5Br3OS — CID 80532508
2-bromo-1-(4,5-dibromothiophen-2-yl)propan-1-one (PubChem CID 80532508) has the molecular formula C7H5Br3OS and a molecular weight of 376.90 g/mol. Its IUPAC name is 2-bromo-1-(4,5-dibromothiophen-2-yl)propan-1-one.
| Compound Name | 2-bromo-1-(4,5-dibromothiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 80532508 |
| Molecular Formula | C7H5Br3OS |
| Molecular Weight | 376.90 g/mol |
| Exact Mass | 373.76 |
| IUPAC Name | 2-bromo-1-(4,5-dibromothiophen-2-yl)propan-1-one |
| SMILES | CC(Br)C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C7H5Br3OS/c1-3(8)6(11)5-2-4(9)7(10)12-5/h2-3H,1H3 |
| InChIKey | SYHVHECLBINJOT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|