C16H16Br2OS — CID 80532609
1-(4,5-dibromothiophen-2-yl)-3-methyl-2-phenylpentan-1-one (PubChem CID 80532609) has the molecular formula C16H16Br2OS and a molecular weight of 416.18 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-3-methyl-2-phenylpentan-1-one.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-3-methyl-2-phenylpentan-1-one |
|---|---|
| PubChem CID | 80532609 |
| Molecular Formula | C16H16Br2OS |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 413.93 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-3-methyl-2-phenylpentan-1-one |
| SMILES | CCC(C)C(C(=O)c1cc(Br)c(Br)s1)c1ccccc1 |
| InChI | InChI=1S/C16H16Br2OS/c1-3-10(2)14(11-7-5-4-6-8-11)15(19)13-9-12(17)16(18)20-13/h4-10,14H,3H2,1-2H3 |
| InChIKey | ADWBCZZLKKZKNU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |