C8H11Br2IN2OS — CID 110191045
[(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide (PubChem CID 110191045) has the molecular formula C8H11Br2IN2OS and a molecular weight of 469.97 g/mol. Its IUPAC name is [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide.
| Compound Name | [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide |
|---|---|
| PubChem CID | 110191045 |
| Molecular Formula | C8H11Br2IN2OS |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 467.80 |
| IUPAC Name | [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)NC(=O)c1cc(Br)c(Br)s1.[I-] |
| InChI | InChI=1S/C8H10Br2N2OS.HI/c1-12(2,3)11-8(13)6-4-5(9)7(10)14-6;/h4H,1-3H3;1H |
| InChIKey | QZGPAZNXVGJYHD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|