About [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide
[(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide (PubChem CID 110191045) has the molecular formula C8H11Br2IN2OS
and a molecular weight of 469.97 g/mol. Its IUPAC name is [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide |
| PubChem CID | 110191045 |
| Molecular Formula | C8H11Br2IN2OS |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 467.80 |
| IUPAC Name | [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)NC(=O)c1cc(Br)c(Br)s1.[I-] |
| InChI | InChI=1S/C8H10Br2N2OS.HI/c1-12(2,3)11-8(13)6-4-5(9)7(10)14-6;/h4H,1-3H3;1H |
| InChIKey | QZGPAZNXVGJYHD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide?
The IUPAC name of [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide (CID 110191045) is [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide.
What is the SMILES notation for [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide?
The canonical SMILES for [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide is C[N+](C)(C)NC(=O)c1cc(Br)c(Br)s1.[I-].
What is the InChIKey of [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide?
The InChIKey is QZGPAZNXVGJYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Br2N2OS.HI/c1-12(2,3)11-8(13)6-4-5(9)7(10)14-6;/h4H,1-3H3;1H.
What are the key properties of [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide?
[(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide has a molecular weight of 469.97 g/mol, XLogP of -0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4,5-dibromothiophene-2-carbonyl)amino]-trimethylazanium iodide is sourced from PubChem (CID 110191045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).