C12H13Br2NOS — CID 31030719
4,5-dibromo-N-(dicyclopropylmethyl)thiophene-2-carboxamide (PubChem CID 31030719) has the molecular formula C12H13Br2NOS and a molecular weight of 379.12 g/mol. Its IUPAC name is 4,5-dibromo-N-(dicyclopropylmethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(dicyclopropylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31030719 |
| Molecular Formula | C12H13Br2NOS |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | 4,5-dibromo-N-(dicyclopropylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NC(C1CC1)C1CC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H13Br2NOS/c13-8-5-9(17-11(8)14)12(16)15-10(6-1-2-6)7-3-4-7/h5-7,10H,1-4H2,(H,15,16) |
| InChIKey | LJBBJERWFWLTTA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |