C15H13Br2NOS — CID 112723097
4,5-dibromo-N-[cyclopropyl(phenyl)methyl]thiophene-2-carboxamide (PubChem CID 112723097) has the molecular formula C15H13Br2NOS and a molecular weight of 415.15 g/mol. Its IUPAC name is 4,5-dibromo-N-[cyclopropyl(phenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[cyclopropyl(phenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112723097 |
| Molecular Formula | C15H13Br2NOS |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | 4,5-dibromo-N-[cyclopropyl(phenyl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)C1CC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H13Br2NOS/c16-11-8-12(20-14(11)17)15(19)18-13(10-6-7-10)9-4-2-1-3-5-9/h1-5,8,10,13H,6-7H2,(H,18,19) |
| InChIKey | UZNXYTRAYPCWEP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |