C19H20BrNO — CID 985964
2-bromo-N-[(S)-cyclopentyl(phenyl)methyl]benzamide (PubChem CID 985964) has the molecular formula C19H20BrNO and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-bromo-N-[(S)-cyclopentyl(phenyl)methyl]benzamide.
| Compound Name | 2-bromo-N-[(S)-cyclopentyl(phenyl)methyl]benzamide |
|---|---|
| PubChem CID | 985964 |
| Molecular Formula | C19H20BrNO |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-bromo-N-[(S)-cyclopentyl(phenyl)methyl]benzamide |
| SMILES | O=C(N[C@H](c1ccccc1)C1CCCC1)c1ccccc1Br |
| InChI | InChI=1S/C19H20BrNO/c20-17-13-7-6-12-16(17)19(22)21-18(15-10-4-5-11-15)14-8-2-1-3-9-14/h1-3,6-9,12-13,15,18H,4-5,10-11H2,(H,21,22)/t18-/m1/s1 |
| InChIKey | SUOUKQXMJVMRGK-GOSISDBHSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |