C23H29NO — CID 7447883
(2S)-N-[(R)-cyclopentyl(phenyl)methyl]-3-methyl-2-phenylbutanamide (PubChem CID 7447883) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (2S)-N-[(R)-cyclopentyl(phenyl)methyl]-3-methyl-2-phenylbutanamide.
| Compound Name | (2S)-N-[(R)-cyclopentyl(phenyl)methyl]-3-methyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 7447883 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2S)-N-[(R)-cyclopentyl(phenyl)methyl]-3-methyl-2-phenylbutanamide |
| SMILES | CC(C)[C@H](C(=O)N[C@@H](c1ccccc1)C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO/c1-17(2)21(18-11-5-3-6-12-18)23(25)24-22(20-15-9-10-16-20)19-13-7-4-8-14-19/h3-8,11-14,17,20-22H,9-10,15-16H2,1-2H3,(H,24,25)/t21-,22-/m0/s1 |
| InChIKey | USTOLXCFVDJPMI-VXKWHMMOSA-N |
| XLogP | 5.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |