C17H25NO3S — CID 94493852
N-[(S)-cyclohexyl(phenyl)methyl]-2-ethylsulfonylacetamide (PubChem CID 94493852) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[(S)-cyclohexyl(phenyl)methyl]-2-ethylsulfonylacetamide.
| Compound Name | N-[(S)-cyclohexyl(phenyl)methyl]-2-ethylsulfonylacetamide |
|---|---|
| PubChem CID | 94493852 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(S)-cyclohexyl(phenyl)methyl]-2-ethylsulfonylacetamide |
| SMILES | CCS(=O)(=O)CC(=O)N[C@H](c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H25NO3S/c1-2-22(20,21)13-16(19)18-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3,5-6,9-10,15,17H,2,4,7-8,11-13H2,1H3,(H,18,19)/t17-/m1/s1 |
| InChIKey | INOMYCFZYYPLBH-QGZVFWFLSA-N |
| XLogP | 2.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |