C24H25NO — CID 2203053
N-[(R)-cyclopentyl(phenyl)methyl]-2-naphthalen-1-ylacetamide (PubChem CID 2203053) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[(R)-cyclopentyl(phenyl)methyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(R)-cyclopentyl(phenyl)methyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 2203053 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(R)-cyclopentyl(phenyl)methyl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)N[C@@H](c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C24H25NO/c26-23(17-21-15-8-14-18-9-6-7-16-22(18)21)25-24(20-12-4-5-13-20)19-10-2-1-3-11-19/h1-3,6-11,14-16,20,24H,4-5,12-13,17H2,(H,25,26)/t24-/m0/s1 |
| InChIKey | MMQSIRAWAYWGKH-DEOSSOPVSA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |