C21H24ClNO3S — CID 39594752
2-(4-chlorophenyl)sulfonyl-N-[(S)-cyclohexyl(phenyl)methyl]acetamide (PubChem CID 39594752) has the molecular formula C21H24ClNO3S and a molecular weight of 405.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[(S)-cyclohexyl(phenyl)methyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[(S)-cyclohexyl(phenyl)methyl]acetamide |
|---|---|
| PubChem CID | 39594752 |
| Molecular Formula | C21H24ClNO3S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[(S)-cyclohexyl(phenyl)methyl]acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)N[C@H](c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H24ClNO3S/c22-18-11-13-19(14-12-18)27(25,26)15-20(24)23-21(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1,3-4,7-8,11-14,17,21H,2,5-6,9-10,15H2,(H,23,24)/t21-/m1/s1 |
| InChIKey | DYXRRJFVRDNOCL-OAQYLSRUSA-N |
| XLogP | 4.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |