C20H18N2O3S — CID 87384206
N-[cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 87384206) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 87384206 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[cyclopropyl-[4-(hydroxycarbamoyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NO)c1ccc(C(NC(=O)c2cc3ccccc3s2)C2CC2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c23-19(22-25)14-9-7-13(8-10-14)18(12-5-6-12)21-20(24)17-11-15-3-1-2-4-16(15)26-17/h1-4,7-12,18,25H,5-6H2,(H,21,24)(H,22,23) |
| InChIKey | KKMYLAURAKVDPU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|