C21H19NO3S — CID 58417207
4-[(1R)-3-(1-benzothiophen-2-yl)-1-cyclopropyl-3-oxopropyl]-N-hydroxybenzamide (PubChem CID 58417207) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-[(1R)-3-(1-benzothiophen-2-yl)-1-cyclopropyl-3-oxopropyl]-N-hydroxybenzamide.
| Compound Name | 4-[(1R)-3-(1-benzothiophen-2-yl)-1-cyclopropyl-3-oxopropyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 58417207 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-[(1R)-3-(1-benzothiophen-2-yl)-1-cyclopropyl-3-oxopropyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc([C@H](CC(=O)c2cc3ccccc3s2)C2CC2)cc1 |
| InChI | InChI=1S/C21H19NO3S/c23-18(20-11-16-3-1-2-4-19(16)26-20)12-17(13-5-6-13)14-7-9-15(10-8-14)21(24)22-25/h1-4,7-11,13,17,25H,5-6,12H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | FHZNHUKGYHNGBT-QGZVFWFLSA-N |
| XLogP | 4.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|