C17H20N2O2S — CID 143199386
N-[(2S)-1-amino-3-cyclopentyl-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 143199386) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-cyclopentyl-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(2S)-1-amino-3-cyclopentyl-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143199386 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[(2S)-1-amino-3-cyclopentyl-1-oxopropan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)[C@H](CC1CCCC1)NC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H20N2O2S/c18-16(20)13(9-11-5-1-2-6-11)19-17(21)15-10-12-7-3-4-8-14(12)22-15/h3-4,7-8,10-11,13H,1-2,5-6,9H2,(H2,18,20)(H,19,21)/t13-/m0/s1 |
| InChIKey | JFSZNORQNTWVIV-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |