C24H28N2OS — CID 68948097
N-[2-[[[(2S)-1-cyclopentylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 68948097) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is N-[2-[[[(2S)-1-cyclopentylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-[[[(2S)-1-cyclopentylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68948097 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[2-[[[(2S)-1-cyclopentylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | C[C@@H](CC1CCCC1)NCc1ccccc1NC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C24H28N2OS/c1-17(14-18-8-2-3-9-18)25-16-20-11-4-6-12-21(20)26-24(27)23-15-19-10-5-7-13-22(19)28-23/h4-7,10-13,15,17-18,25H,2-3,8-9,14,16H2,1H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | CRFRVTMXXVLAHH-KRWDZBQOSA-N |
| XLogP | 6.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |