C24H31N3OS — CID 87632933
1-(benzenecarbonothioyl)-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea (PubChem CID 87632933) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-(benzenecarbonothioyl)-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea.
| Compound Name | 1-(benzenecarbonothioyl)-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea |
|---|---|
| PubChem CID | 87632933 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-(benzenecarbonothioyl)-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea |
| SMILES | CC(CC1CCCCC1)NCc1ccccc1NC(=O)NC(=S)c1ccccc1 |
| InChI | InChI=1S/C24H31N3OS/c1-18(16-19-10-4-2-5-11-19)25-17-21-14-8-9-15-22(21)26-24(28)27-23(29)20-12-6-3-7-13-20/h3,6-9,12-15,18-19,25H,2,4-5,10-11,16-17H2,1H3,(H2,26,27,28,29) |
| InChIKey | AKDRPLAUCPXUIQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|