C18H31N3O2S — CID 68948994
1-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]-2-(dimethylsulfamoylamino)benzene (PubChem CID 68948994) has the molecular formula C18H31N3O2S and a molecular weight of 353.53 g/mol. Its IUPAC name is 1-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]-2-(dimethylsulfamoylamino)benzene.
| Compound Name | 1-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]-2-(dimethylsulfamoylamino)benzene |
|---|---|
| PubChem CID | 68948994 |
| Molecular Formula | C18H31N3O2S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]-2-(dimethylsulfamoylamino)benzene |
| SMILES | C[C@@H](CC1CCCCC1)NCc1ccccc1NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H31N3O2S/c1-15(13-16-9-5-4-6-10-16)19-14-17-11-7-8-12-18(17)20-24(22,23)21(2)3/h7-8,11-12,15-16,19-20H,4-6,9-10,13-14H2,1-3H3/t15-/m0/s1 |
| InChIKey | SJCIATPWHHBCNF-HNNXBMFYSA-N |
| XLogP | 3.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |