C24H30N2O2S2 — CID 11978721
N-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-sulfonamide (PubChem CID 11978721) has the molecular formula C24H30N2O2S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is N-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11978721 |
| Molecular Formula | C24H30N2O2S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[2-[[[(2S)-1-cyclohexylpropan-2-yl]amino]methyl]phenyl]-1-benzothiophene-2-sulfonamide |
| SMILES | C[C@@H](CC1CCCCC1)NCc1ccccc1NS(=O)(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C24H30N2O2S2/c1-18(15-19-9-3-2-4-10-19)25-17-21-12-5-7-13-22(21)26-30(27,28)24-16-20-11-6-8-14-23(20)29-24/h5-8,11-14,16,18-19,25-26H,2-4,9-10,15,17H2,1H3/t18-/m0/s1 |
| InChIKey | UBWHXRCFLZJIOO-SFHVURJKSA-N |
| XLogP | 6.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |